C11H14F3NS — CID 105142670
3-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 105142670) has the molecular formula C11H14F3NS and a molecular weight of 249.30 g/mol. Its IUPAC name is 3-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 3-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 105142670 |
| Molecular Formula | C11H14F3NS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 3-methylsulfanyl-1-[4-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CSCCC(N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NS/c1-16-7-6-10(15)8-2-4-9(5-3-8)11(12,13)14/h2-5,10H,6-7,15H2,1H3 |
| InChIKey | SQPMLFRHEPWRIP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |