C13H18F3NS — CID 65132708
2-tert-butylsulfanyl-1-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 65132708) has the molecular formula C13H18F3NS and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-1-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-tert-butylsulfanyl-1-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 65132708 |
| Molecular Formula | C13H18F3NS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-tert-butylsulfanyl-1-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(C)(C)SCC(N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NS/c1-12(2,3)18-8-11(17)9-4-6-10(7-5-9)13(14,15)16/h4-7,11H,8,17H2,1-3H3 |
| InChIKey | GGMXJYFKBZUTQT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |