C11H14F3NO — CID 62790379
3-methoxy-1-[4-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 62790379) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-methoxy-1-[4-(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 3-methoxy-1-[4-(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 62790379 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-methoxy-1-[4-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | COCCC(N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO/c1-16-7-6-10(15)8-2-4-9(5-3-8)11(12,13)14/h2-5,10H,6-7,15H2,1H3 |
| InChIKey | GSGBMMQWIQEYDR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |