C11H15F3N2 — CID 171218575
(1S)-1-[4-(trifluoromethyl)phenyl]butane-1,4-diamine (PubChem CID 171218575) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is (1S)-1-[4-(trifluoromethyl)phenyl]butane-1,4-diamine.
| Compound Name | (1S)-1-[4-(trifluoromethyl)phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 171218575 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (1S)-1-[4-(trifluoromethyl)phenyl]butane-1,4-diamine |
| SMILES | NCCC[C@H](N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H15F3N2/c12-11(13,14)9-5-3-8(4-6-9)10(16)2-1-7-15/h3-6,10H,1-2,7,15-16H2/t10-/m0/s1 |
| InChIKey | SXJZZCQVKIKXRZ-JTQLQIEISA-N |
| XLogP | 2.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |