C11H14F4N2 — CID 171209518
(1R)-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,4-diamine (PubChem CID 171209518) has the molecular formula C11H14F4N2 and a molecular weight of 250.24 g/mol. Its IUPAC name is (1R)-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,4-diamine.
| Compound Name | (1R)-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 171209518 |
| Molecular Formula | C11H14F4N2 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (1R)-1-[2-fluoro-5-(trifluoromethyl)phenyl]butane-1,4-diamine |
| SMILES | NCCC[C@@H](N)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H14F4N2/c12-9-4-3-7(11(13,14)15)6-8(9)10(17)2-1-5-16/h3-4,6,10H,1-2,5,16-17H2/t10-/m1/s1 |
| InChIKey | UJCRYNSYRLWPLI-SNVBAGLBSA-N |
| XLogP | 2.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |