C11H12F6N2 — CID 171228404
(1S)-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine (PubChem CID 171228404) has the molecular formula C11H12F6N2 and a molecular weight of 286.22 g/mol. Its IUPAC name is (1S)-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine.
| Compound Name | (1S)-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 171228404 |
| Molecular Formula | C11H12F6N2 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (1S)-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,3-diamine |
| SMILES | NCC[C@H](N)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F6N2/c12-10(13,14)6-1-2-8(11(15,16)17)7(5-6)9(19)3-4-18/h1-2,5,9H,3-4,18-19H2/t9-/m0/s1 |
| InChIKey | LHEOXYPEUPERRX-VIFPVBQESA-N |
| XLogP | 3.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |