C11H11F6NO2 — CID 170829214
3-amino-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,2-diol (PubChem CID 170829214) has the molecular formula C11H11F6NO2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 3-amino-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-amino-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170829214 |
| Molecular Formula | C11H11F6NO2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-amino-1-[2,5-bis(trifluoromethyl)phenyl]propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H11F6NO2/c12-10(13,14)5-1-2-7(11(15,16)17)6(3-5)9(20)8(19)4-18/h1-3,8-9,19-20H,4,18H2 |
| InChIKey | UBHIAUFFORWZHC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |