C14H17F6NO — CID 171269411
(1S,2R)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]-3-methylpentan-2-ol (PubChem CID 171269411) has the molecular formula C14H17F6NO and a molecular weight of 329.28 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]-3-methylpentan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 171269411 |
| Molecular Formula | C14H17F6NO |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (1S,2R)-1-amino-1-[2,5-bis(trifluoromethyl)phenyl]-3-methylpentan-2-ol |
| SMILES | CCC(C)[C@@H](O)[C@@H](N)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C14H17F6NO/c1-3-7(2)12(22)11(21)9-6-8(13(15,16)17)4-5-10(9)14(18,19)20/h4-7,11-12,22H,3,21H2,1-2H3/t7?,11-,12+/m0/s1 |
| InChIKey | KZJGUJOYKUOSEW-FRJORHAFSA-N |
| XLogP | 4.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |