C13H15F6N — CID 171210265
(1R)-1-[2,4-bis(trifluoromethyl)phenyl]-2-methylbutan-1-amine (PubChem CID 171210265) has the molecular formula C13H15F6N and a molecular weight of 299.26 g/mol. Its IUPAC name is (1R)-1-[2,4-bis(trifluoromethyl)phenyl]-2-methylbutan-1-amine.
| Compound Name | (1R)-1-[2,4-bis(trifluoromethyl)phenyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 171210265 |
| Molecular Formula | C13H15F6N |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (1R)-1-[2,4-bis(trifluoromethyl)phenyl]-2-methylbutan-1-amine |
| SMILES | CCC(C)[C@@H](N)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F6N/c1-3-7(2)11(20)9-5-4-8(12(14,15)16)6-10(9)13(17,18)19/h4-7,11H,3,20H2,1-2H3/t7?,11-/m1/s1 |
| InChIKey | PDLWWHOZLQXKIW-PLNQYNMKSA-N |
| XLogP | 4.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |