C18H20F3N — CID 171231162
(1S)-2-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-amine (PubChem CID 171231162) has the molecular formula C18H20F3N and a molecular weight of 307.36 g/mol. Its IUPAC name is (1S)-2-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-amine.
| Compound Name | (1S)-2-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-amine |
|---|---|
| PubChem CID | 171231162 |
| Molecular Formula | C18H20F3N |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (1S)-2-methyl-1-[4-[4-(trifluoromethyl)phenyl]phenyl]butan-1-amine |
| SMILES | CCC(C)[C@H](N)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H20F3N/c1-3-12(2)17(22)15-6-4-13(5-7-15)14-8-10-16(11-9-14)18(19,20)21/h4-12,17H,3,22H2,1-2H3/t12?,17-/m0/s1 |
| InChIKey | GYQJAPVDPZBQQP-TYJDENFWSA-N |
| XLogP | 5.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |