C11H10F6 — CID 20613821
1-propan-2-yl-2,4-bis(trifluoromethyl)benzene (PubChem CID 20613821) has the molecular formula C11H10F6 and a molecular weight of 256.19 g/mol. Its IUPAC name is 1-propan-2-yl-2,4-bis(trifluoromethyl)benzene.
| Compound Name | 1-propan-2-yl-2,4-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20613821 |
| Molecular Formula | C11H10F6 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-propan-2-yl-2,4-bis(trifluoromethyl)benzene |
| SMILES | CC(C)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10F6/c1-6(2)8-4-3-7(10(12,13)14)5-9(8)11(15,16)17/h3-6H,1-2H3 |
| InChIKey | LJVUDTUWCHMRAU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |