C11H13F3O — CID 20755055
4-methoxy-1-propan-2-yl-2-(trifluoromethyl)benzene (PubChem CID 20755055) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-methoxy-1-propan-2-yl-2-(trifluoromethyl)benzene.
| Compound Name | 4-methoxy-1-propan-2-yl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20755055 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-methoxy-1-propan-2-yl-2-(trifluoromethyl)benzene |
| SMILES | COc1ccc(C(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3O/c1-7(2)9-5-4-8(15-3)6-10(9)11(12,13)14/h4-7H,1-3H3 |
| InChIKey | QJOMMLUOUVXALF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |