C12H17F3N2O — CID 171227710
(1S)-1-[4-methoxy-2-(trifluoromethyl)phenyl]butane-1,4-diamine (PubChem CID 171227710) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is (1S)-1-[4-methoxy-2-(trifluoromethyl)phenyl]butane-1,4-diamine.
| Compound Name | (1S)-1-[4-methoxy-2-(trifluoromethyl)phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 171227710 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (1S)-1-[4-methoxy-2-(trifluoromethyl)phenyl]butane-1,4-diamine |
| SMILES | COc1ccc([C@@H](N)CCCN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O/c1-18-8-4-5-9(11(17)3-2-6-16)10(7-8)12(13,14)15/h4-5,7,11H,2-3,6,16-17H2,1H3/t11-/m0/s1 |
| InChIKey | PMTVJSHOHAASFC-NSHDSACASA-N |
| XLogP | 2.45 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |