C10H15FN2O — CID 171219591
(1S)-1-(2-fluoro-4-methoxyphenyl)propane-1,3-diamine (PubChem CID 171219591) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is (1S)-1-(2-fluoro-4-methoxyphenyl)propane-1,3-diamine.
| Compound Name | (1S)-1-(2-fluoro-4-methoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 171219591 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (1S)-1-(2-fluoro-4-methoxyphenyl)propane-1,3-diamine |
| SMILES | COc1ccc([C@@H](N)CCN)c(F)c1 |
| InChI | InChI=1S/C10H15FN2O/c1-14-7-2-3-8(9(11)6-7)10(13)4-5-12/h2-3,6,10H,4-5,12-13H2,1H3/t10-/m0/s1 |
| InChIKey | RNVBNEJZQFFRMJ-JTQLQIEISA-N |
| XLogP | 1.18 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |