C13H21ClFNO — CID 171219626
(1S)-1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-1-amine;hydrochloride (PubChem CID 171219626) has the molecular formula C13H21ClFNO and a molecular weight of 261.77 g/mol. Its IUPAC name is (1S)-1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171219626 |
| Molecular Formula | C13H21ClFNO |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (1S)-1-(2-fluoro-4-methoxyphenyl)-4-methylpentan-1-amine;hydrochloride |
| SMILES | COc1ccc([C@@H](N)CCC(C)C)c(F)c1.Cl |
| InChI | InChI=1S/C13H20FNO.ClH/c1-9(2)4-7-13(15)11-6-5-10(16-3)8-12(11)14;/h5-6,8-9,13H,4,7,15H2,1-3H3;1H/t13-;/m0./s1 |
| InChIKey | CDASJQULOOPFIW-ZOWNYOTGSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |