C14H24ClNO2 — CID 171220642
(1S)-1-(2,4-dimethoxyphenyl)-4-methylpentan-1-amine;hydrochloride (PubChem CID 171220642) has the molecular formula C14H24ClNO2 and a molecular weight of 273.80 g/mol. Its IUPAC name is (1S)-1-(2,4-dimethoxyphenyl)-4-methylpentan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,4-dimethoxyphenyl)-4-methylpentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171220642 |
| Molecular Formula | C14H24ClNO2 |
| Molecular Weight | 273.80 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (1S)-1-(2,4-dimethoxyphenyl)-4-methylpentan-1-amine;hydrochloride |
| SMILES | COc1ccc([C@@H](N)CCC(C)C)c(OC)c1.Cl |
| InChI | InChI=1S/C14H23NO2.ClH/c1-10(2)5-8-13(15)12-7-6-11(16-3)9-14(12)17-4;/h6-7,9-10,13H,5,8,15H2,1-4H3;1H/t13-;/m0./s1 |
| InChIKey | CNDWRPSQQAZWTE-ZOWNYOTGSA-N |
| XLogP | 3.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |