C10H16ClNO3 — CID 162344444
2-amino-2-(2,4-dimethoxyphenyl)ethanol;hydrochloride (PubChem CID 162344444) has the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. Its IUPAC name is 2-amino-2-(2,4-dimethoxyphenyl)ethanol;hydrochloride.
| Compound Name | 2-amino-2-(2,4-dimethoxyphenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 162344444 |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-amino-2-(2,4-dimethoxyphenyl)ethanol;hydrochloride |
| SMILES | COc1ccc(C(N)CO)c(OC)c1.Cl |
| InChI | InChI=1S/C10H15NO3.ClH/c1-13-7-3-4-8(9(11)6-12)10(5-7)14-2;/h3-5,9,12H,6,11H2,1-2H3;1H |
| InChIKey | REHHXCUVCHMISX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |