C13H20ClNO4 — CID 171201109
ethyl (3R)-3-amino-3-(2,4-dimethoxyphenyl)propanoate;hydrochloride (PubChem CID 171201109) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(2,4-dimethoxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-3-(2,4-dimethoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171201109 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl (3R)-3-amino-3-(2,4-dimethoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@@H](N)c1ccc(OC)cc1OC.Cl |
| InChI | InChI=1S/C13H19NO4.ClH/c1-4-18-13(15)8-11(14)10-6-5-9(16-2)7-12(10)17-3;/h5-7,11H,4,8,14H2,1-3H3;1H/t11-;/m1./s1 |
| InChIKey | OUUKLJSGTIUSIM-RFVHGSKJSA-N |
| XLogP | 2.08 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |