C12H17NO3 — CID 116940526
4-amino-4-(2,4-dimethoxyphenyl)butan-2-one (PubChem CID 116940526) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-amino-4-(2,4-dimethoxyphenyl)butan-2-one.
| Compound Name | 4-amino-4-(2,4-dimethoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 116940526 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-amino-4-(2,4-dimethoxyphenyl)butan-2-one |
| SMILES | COc1ccc(C(N)CC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C12H17NO3/c1-8(14)6-11(13)10-5-4-9(15-2)7-12(10)16-3/h4-5,7,11H,6,13H2,1-3H3 |
| InChIKey | NFGCTRXFZWUYME-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |