C12H17BrClNO3 — CID 171204821
ethyl (3R)-3-amino-3-(4-bromo-2-methoxyphenyl)propanoate;hydrochloride (PubChem CID 171204821) has the molecular formula C12H17BrClNO3 and a molecular weight of 338.63 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(4-bromo-2-methoxyphenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-3-(4-bromo-2-methoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171204821 |
| Molecular Formula | C12H17BrClNO3 |
| Molecular Weight | 338.63 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | ethyl (3R)-3-amino-3-(4-bromo-2-methoxyphenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@@H](N)c1ccc(Br)cc1OC.Cl |
| InChI | InChI=1S/C12H16BrNO3.ClH/c1-3-17-12(15)7-10(14)9-5-4-8(13)6-11(9)16-2;/h4-6,10H,3,7,14H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | DZPXHQYJKMPOQP-HNCPQSOCSA-N |
| XLogP | 2.83 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |