C9H12BrNO2 — CID 66515456
(2S)-2-amino-2-(4-bromo-2-methoxyphenyl)ethanol (PubChem CID 66515456) has the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. Its IUPAC name is (2S)-2-amino-2-(4-bromo-2-methoxyphenyl)ethanol.
| Compound Name | (2S)-2-amino-2-(4-bromo-2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 66515456 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | (2S)-2-amino-2-(4-bromo-2-methoxyphenyl)ethanol |
| SMILES | COc1cc(Br)ccc1[C@H](N)CO |
| InChI | InChI=1S/C9H12BrNO2/c1-13-9-4-6(10)2-3-7(9)8(11)5-12/h2-4,8,12H,5,11H2,1H3/t8-/m1/s1 |
| InChIKey | IORLMMQRQVGMDV-MRVPVSSYSA-N |
| XLogP | 1.45 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |