C12H18BrNO — CID 171204790
(1R)-1-(4-bromo-2-methoxyphenyl)-3-methylbutan-1-amine (PubChem CID 171204790) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is (1R)-1-(4-bromo-2-methoxyphenyl)-3-methylbutan-1-amine.
| Compound Name | (1R)-1-(4-bromo-2-methoxyphenyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 171204790 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (1R)-1-(4-bromo-2-methoxyphenyl)-3-methylbutan-1-amine |
| SMILES | COc1cc(Br)ccc1[C@H](N)CC(C)C |
| InChI | InChI=1S/C12H18BrNO/c1-8(2)6-11(14)10-5-4-9(13)7-12(10)15-3/h4-5,7-8,11H,6,14H2,1-3H3/t11-/m1/s1 |
| InChIKey | MJMNOMWZHGGIHR-LLVKDONJSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |