C10H13ClF3NO3 — CID 171236237
(2R)-2-amino-2-[2-methoxy-4-(trifluoromethoxy)phenyl]ethanol;hydrochloride (PubChem CID 171236237) has the molecular formula C10H13ClF3NO3 and a molecular weight of 287.67 g/mol. Its IUPAC name is (2R)-2-amino-2-[2-methoxy-4-(trifluoromethoxy)phenyl]ethanol;hydrochloride.
| Compound Name | (2R)-2-amino-2-[2-methoxy-4-(trifluoromethoxy)phenyl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 171236237 |
| Molecular Formula | C10H13ClF3NO3 |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (2R)-2-amino-2-[2-methoxy-4-(trifluoromethoxy)phenyl]ethanol;hydrochloride |
| SMILES | COc1cc(OC(F)(F)F)ccc1[C@@H](N)CO.Cl |
| InChI | InChI=1S/C10H12F3NO3.ClH/c1-16-9-4-6(17-10(11,12)13)2-3-7(9)8(14)5-15;/h2-4,8,15H,5,14H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | JHJGJECNBRVBDD-QRPNPIFTSA-N |
| XLogP | 2.01 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |