C13H20ClF3N2O2 — CID 171216555
(1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride (PubChem CID 171216555) has the molecular formula C13H20ClF3N2O2 and a molecular weight of 328.76 g/mol. Its IUPAC name is (1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride.
| Compound Name | (1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171216555 |
| Molecular Formula | C13H20ClF3N2O2 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (1R)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]pentane-1,5-diamine;hydrochloride |
| SMILES | COc1cc(OC(F)(F)F)ccc1[C@H](N)CCCCN.Cl |
| InChI | InChI=1S/C13H19F3N2O2.ClH/c1-19-12-8-9(20-13(14,15)16)5-6-10(12)11(18)4-2-3-7-17;/h5-6,8,11H,2-4,7,17-18H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | BQVHCKUHLGHKSG-RFVHGSKJSA-N |
| XLogP | 3.14 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|