C13H19ClF3NO2 — CID 171236205
(1S)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 171236205) has the molecular formula C13H19ClF3NO2 and a molecular weight of 313.75 g/mol. Its IUPAC name is (1S)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | (1S)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171236205 |
| Molecular Formula | C13H19ClF3NO2 |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (1S)-1-[2-methoxy-4-(trifluoromethoxy)phenyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | COc1cc(OC(F)(F)F)ccc1[C@@H](N)CC(C)C.Cl |
| InChI | InChI=1S/C13H18F3NO2.ClH/c1-8(2)6-11(17)10-5-4-9(7-12(10)18-3)19-13(14,15)16;/h4-5,7-8,11H,6,17H2,1-3H3;1H/t11-;/m0./s1 |
| InChIKey | FLGRWQNQIMPYOJ-MERQFXBCSA-N |
| XLogP | 4.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |