C12H17F3N2O — CID 83988086
2-(1-amino-3-methylbutyl)-4-(trifluoromethoxy)aniline (PubChem CID 83988086) has the molecular formula C12H17F3N2O and a molecular weight of 262.28 g/mol. Its IUPAC name is 2-(1-amino-3-methylbutyl)-4-(trifluoromethoxy)aniline.
| Compound Name | 2-(1-amino-3-methylbutyl)-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 83988086 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(1-amino-3-methylbutyl)-4-(trifluoromethoxy)aniline |
| SMILES | CC(C)CC(N)c1cc(OC(F)(F)F)ccc1N |
| InChI | InChI=1S/C12H17F3N2O/c1-7(2)5-11(17)9-6-8(3-4-10(9)16)18-12(13,14)15/h3-4,6-7,11H,5,16-17H2,1-2H3 |
| InChIKey | APKOFISHPIDEBC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|