C11H11F6NO2 — CID 139965810
1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-amine (PubChem CID 139965810) has the molecular formula C11H11F6NO2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-amine.
| Compound Name | 1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 139965810 |
| Molecular Formula | C11H11F6NO2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-amine |
| SMILES | CCC(N)c1cc(OC(F)(F)F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C11H11F6NO2/c1-2-8(18)7-5-6(19-10(12,13)14)3-4-9(7)20-11(15,16)17/h3-5,8H,2,18H2,1H3 |
| InChIKey | CHFLFDQFRRFZQT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |