C11H10F6O3 — CID 139965700
1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-ol (PubChem CID 139965700) has the molecular formula C11H10F6O3 and a molecular weight of 304.19 g/mol. Its IUPAC name is 1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-ol.
| Compound Name | 1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 139965700 |
| Molecular Formula | C11H10F6O3 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-[2,5-bis(trifluoromethoxy)phenyl]propan-1-ol |
| SMILES | CCC(O)c1cc(OC(F)(F)F)ccc1OC(F)(F)F |
| InChI | InChI=1S/C11H10F6O3/c1-2-8(18)7-5-6(19-10(12,13)14)3-4-9(7)20-11(15,16)17/h3-5,8,18H,2H2,1H3 |
| InChIKey | XIKHDITVGUKNME-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |