C10H13ClF3NO2 — CID 171208716
(1R)-1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanamine;hydrochloride (PubChem CID 171208716) has the molecular formula C10H13ClF3NO2 and a molecular weight of 271.67 g/mol. Its IUPAC name is (1R)-1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanamine;hydrochloride.
| Compound Name | (1R)-1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171208716 |
| Molecular Formula | C10H13ClF3NO2 |
| Molecular Weight | 271.67 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (1R)-1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
| SMILES | COc1ccc(OC(F)(F)F)cc1[C@@H](C)N.Cl |
| InChI | InChI=1S/C10H12F3NO2.ClH/c1-6(14)8-5-7(16-10(11,12)13)3-4-9(8)15-2;/h3-6H,14H2,1-2H3;1H/t6-;/m1./s1 |
| InChIKey | UJQJGKFOJIMCHL-FYZOBXCZSA-N |
| XLogP | 3.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |