C10H12F3NO3 — CID 66515505
(2R)-2-amino-2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanol (PubChem CID 66515505) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is (2R)-2-amino-2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | (2R)-2-amino-2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 66515505 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | (2R)-2-amino-2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanol |
| SMILES | COc1ccc(OC(F)(F)F)cc1[C@@H](N)CO |
| InChI | InChI=1S/C10H12F3NO3/c1-16-9-3-2-6(17-10(11,12)13)4-7(9)8(14)5-15/h2-4,8,15H,5,14H2,1H3/t8-/m0/s1 |
| InChIKey | SQDWDGXQFQDNGN-QMMMGPOBSA-N |
| XLogP | 1.59 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |