C11H13F4NO — CID 171235861
(1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]butan-1-amine (PubChem CID 171235861) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]butan-1-amine.
| Compound Name | (1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 171235861 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (1S)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]butan-1-amine |
| SMILES | CCC[C@H](N)c1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C11H13F4NO/c1-2-3-10(16)8-6-7(4-5-9(8)12)17-11(13,14)15/h4-6,10H,2-3,16H2,1H3/t10-/m0/s1 |
| InChIKey | WMSQVQJBBFNVIL-JTQLQIEISA-N |
| XLogP | 3.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |