C11H12ClF4NO — CID 171216230
(1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-en-1-amine;hydrochloride (PubChem CID 171216230) has the molecular formula C11H12ClF4NO and a molecular weight of 285.67 g/mol. Its IUPAC name is (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171216230 |
| Molecular Formula | C11H12ClF4NO |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cc(OC(F)(F)F)ccc1F.Cl |
| InChI | InChI=1S/C11H11F4NO.ClH/c1-2-3-10(16)8-6-7(4-5-9(8)12)17-11(13,14)15;/h2,4-6,10H,1,3,16H2;1H/t10-;/m1./s1 |
| InChIKey | PPGIKCBENNMMOY-HNCPQSOCSA-N |
| XLogP | 3.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|