C10H7ClF9NO — CID 171312744
(1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-5-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride (PubChem CID 171312744) has the molecular formula C10H7ClF9NO and a molecular weight of 363.61 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-5-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-5-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312744 |
| Molecular Formula | C10H7ClF9NO |
| Molecular Weight | 363.61 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-5-(trifluoromethoxy)phenyl]propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(OC(F)(F)F)ccc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F9NO.ClH/c11-6-2-1-4(21-10(17,18)19)3-5(6)7(20)8(12,13)9(14,15)16;/h1-3,7H,20H2;1H/t7-;/m1./s1 |
| InChIKey | ICKFWSPAAQUDRE-OGFXRTJISA-N |
| XLogP | 4.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|