C10H9F4NO — CID 171216225
(1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-en-1-amine (PubChem CID 171216225) has the molecular formula C10H9F4NO and a molecular weight of 235.18 g/mol. Its IUPAC name is (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-en-1-amine.
| Compound Name | (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 171216225 |
| Molecular Formula | C10H9F4NO |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]prop-2-en-1-amine |
| SMILES | C=C[C@@H](N)c1cc(OC(F)(F)F)ccc1F |
| InChI | InChI=1S/C10H9F4NO/c1-2-9(15)7-5-6(3-4-8(7)11)16-10(12,13)14/h2-5,9H,1,15H2/t9-/m1/s1 |
| InChIKey | GQYBXZYOLBUMPW-SECBINFHSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|