C9H6ClF8N — CID 171312382
(1R)-2,2,3,3,3-pentafluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride (PubChem CID 171312382) has the molecular formula C9H6ClF8N and a molecular weight of 315.59 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312382 |
| Molecular Formula | C9H6ClF8N |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(F)c(F)c1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F8N.ClH/c10-4-2-1-3(5(11)6(4)12)7(18)8(13,14)9(15,16)17;/h1-2,7H,18H2;1H/t7-;/m1./s1 |
| InChIKey | QSODUNNYCJJVAZ-OGFXRTJISA-N |
| XLogP | 3.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|