C9H6BrF6N — CID 171311425
(1S)-1-(4-bromo-2-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 171311425) has the molecular formula C9H6BrF6N and a molecular weight of 322.05 g/mol. Its IUPAC name is (1S)-1-(4-bromo-2-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | (1S)-1-(4-bromo-2-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 171311425 |
| Molecular Formula | C9H6BrF6N |
| Molecular Weight | 322.05 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | (1S)-1-(4-bromo-2-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | N[C@@H](c1ccc(Br)cc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6BrF6N/c10-4-1-2-5(6(11)3-4)7(17)8(12,13)9(14,15)16/h1-3,7H,17H2/t7-/m0/s1 |
| InChIKey | HDHDWZIGKKPIFO-ZETCQYMHSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.05 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|