C10H7ClF9N — CID 171312446
(1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (PubChem CID 171312446) has the molecular formula C10H7ClF9N and a molecular weight of 347.61 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312446 |
| Molecular Formula | C10H7ClF9N |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc(C(F)(F)F)cc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F9N.ClH/c11-6-3-4(9(14,15)16)1-2-5(6)7(20)8(12,13)10(17,18)19;/h1-3,7H,20H2;1H/t7-;/m1./s1 |
| InChIKey | LJRXVSUFYCYJHE-OGFXRTJISA-N |
| XLogP | 4.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|