C9H8F5N — CID 131344633
(1R)-2-fluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 131344633) has the molecular formula C9H8F5N and a molecular weight of 225.16 g/mol. Its IUPAC name is (1R)-2-fluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | (1R)-2-fluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 131344633 |
| Molecular Formula | C9H8F5N |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (1R)-2-fluoro-1-[2-fluoro-4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | N[C@@H](CF)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H8F5N/c10-4-8(15)6-2-1-5(3-7(6)11)9(12,13)14/h1-3,8H,4,15H2/t8-/m0/s1 |
| InChIKey | UWIJDZHWHLBGJJ-QMMMGPOBSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |