C12H13F4NO2 — CID 171207391
ethyl (3R)-3-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]propanoate (PubChem CID 171207391) has the molecular formula C12H13F4NO2 and a molecular weight of 279.23 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl (3R)-3-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 171207391 |
| Molecular Formula | C12H13F4NO2 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl (3R)-3-amino-3-[2-fluoro-4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C[C@@H](N)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H13F4NO2/c1-2-19-11(18)6-10(17)8-4-3-7(5-9(8)13)12(14,15)16/h3-5,10H,2,6,17H2,1H3/t10-/m1/s1 |
| InChIKey | YBTQCUMZPMPOEY-SNVBAGLBSA-N |
| XLogP | 2.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |