C11H14Cl2FNO2 — CID 171202939
ethyl (3R)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate;hydrochloride (PubChem CID 171202939) has the molecular formula C11H14Cl2FNO2 and a molecular weight of 282.14 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171202939 |
| Molecular Formula | C11H14Cl2FNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | ethyl (3R)-3-amino-3-(4-chloro-2-fluorophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@@H](N)c1ccc(Cl)cc1F.Cl |
| InChI | InChI=1S/C11H13ClFNO2.ClH/c1-2-16-11(15)6-10(14)8-4-3-7(12)5-9(8)13;/h3-5,10H,2,6,14H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | JJHRWHOBHSDXIF-HNCPQSOCSA-N |
| XLogP | 2.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |