C11H13ClF3NO2 — CID 171209934
ethyl (3R)-3-amino-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride (PubChem CID 171209934) has the molecular formula C11H13ClF3NO2 and a molecular weight of 283.68 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171209934 |
| Molecular Formula | C11H13ClF3NO2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | ethyl (3R)-3-amino-3-(2,4,5-trifluorophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@@H](N)c1cc(F)c(F)cc1F.Cl |
| InChI | InChI=1S/C11H12F3NO2.ClH/c1-2-17-11(16)5-10(15)6-3-8(13)9(14)4-7(6)12;/h3-4,10H,2,5,15H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | WECYUPSKGPNJKF-HNCPQSOCSA-N |
| XLogP | 2.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|