C12H15BrFNO2 — CID 176789119
ethyl 3-amino-3-(5-bromo-3-fluoro-2-methylphenyl)propanoate (PubChem CID 176789119) has the molecular formula C12H15BrFNO2 and a molecular weight of 304.16 g/mol. Its IUPAC name is ethyl 3-amino-3-(5-bromo-3-fluoro-2-methylphenyl)propanoate.
| Compound Name | ethyl 3-amino-3-(5-bromo-3-fluoro-2-methylphenyl)propanoate |
|---|---|
| PubChem CID | 176789119 |
| Molecular Formula | C12H15BrFNO2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | ethyl 3-amino-3-(5-bromo-3-fluoro-2-methylphenyl)propanoate |
| SMILES | CCOC(=O)CC(N)c1cc(Br)cc(F)c1C |
| InChI | InChI=1S/C12H15BrFNO2/c1-3-17-12(16)6-11(15)9-4-8(13)5-10(14)7(9)2/h4-5,11H,3,6,15H2,1-2H3 |
| InChIKey | DEIAJKMXEHQWOI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |