C10H10BrF2NO2 — CID 171248588
methyl (3R)-3-amino-3-(4-bromo-2,6-difluorophenyl)propanoate (PubChem CID 171248588) has the molecular formula C10H10BrF2NO2 and a molecular weight of 294.10 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(4-bromo-2,6-difluorophenyl)propanoate.
| Compound Name | methyl (3R)-3-amino-3-(4-bromo-2,6-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 171248588 |
| Molecular Formula | C10H10BrF2NO2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | methyl (3R)-3-amino-3-(4-bromo-2,6-difluorophenyl)propanoate |
| SMILES | COC(=O)C[C@@H](N)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H10BrF2NO2/c1-16-9(15)4-8(14)10-6(12)2-5(11)3-7(10)13/h2-3,8H,4,14H2,1H3/t8-/m1/s1 |
| InChIKey | IOYMWUBKHPDJLP-MRVPVSSYSA-N |
| XLogP | 2.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |