methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate

C9H10Br2N2O2 — CID 112704590

IUPACmethyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate
SMILESCOC(=O)CC(N)c1ncc(Br)cc1Br
InChIInChI=1S/C9H10Br2N2O2/c1-15-8(14)3-7(12)9-6(11)2-5(10)4-13-9/h2,4,7H,3,12H2,1H3
InChIKeyGRDAQYNRZQBDQM-UHFFFAOYSA-N
MW338.00 g/mol
LogP2.17
Rot. Bonds3

About methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate

methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate (PubChem CID 112704590) has the molecular formula C9H10Br2N2O2 and a molecular weight of 338.00 g/mol. Its IUPAC name is methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate.

Molecular Properties

Compound Namemethyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate
PubChem CID112704590
Molecular FormulaC9H10Br2N2O2
Molecular Weight338.00 g/mol
Exact Mass335.91
IUPAC Namemethyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate
SMILESCOC(=O)CC(N)c1ncc(Br)cc1Br
InChIInChI=1S/C9H10Br2N2O2/c1-15-8(14)3-7(12)9-6(11)2-5(10)4-13-9/h2,4,7H,3,12H2,1H3
InChIKeyGRDAQYNRZQBDQM-UHFFFAOYSA-N
XLogP2.17
TPSA65.21 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500338.00
LogP ≤ 52.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate?
The IUPAC name of methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate (CID 112704590) is methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate.
What is the SMILES notation for methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate?
The canonical SMILES for methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate is COC(=O)CC(N)c1ncc(Br)cc1Br.
What is the InChIKey of methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate?
The InChIKey is GRDAQYNRZQBDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Br2N2O2/c1-15-8(14)3-7(12)9-6(11)2-5(10)4-13-9/h2,4,7H,3,12H2,1H3.
What are the key properties of methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate?
methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate has a molecular weight of 338.00 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-3-(3,5-dibromo-2-pyridinyl)propanoate is sourced from PubChem (CID 112704590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).