C10H11ClF3NO3 — CID 171257703
methyl (3R)-3-amino-3-(2,3,4-trifluoro-6-hydroxyphenyl)propanoate;hydrochloride (PubChem CID 171257703) has the molecular formula C10H11ClF3NO3 and a molecular weight of 285.65 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(2,3,4-trifluoro-6-hydroxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(2,3,4-trifluoro-6-hydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171257703 |
| Molecular Formula | C10H11ClF3NO3 |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | methyl (3R)-3-amino-3-(2,3,4-trifluoro-6-hydroxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1c(O)cc(F)c(F)c1F.Cl |
| InChI | InChI=1S/C10H10F3NO3.ClH/c1-17-7(16)3-5(14)8-6(15)2-4(11)9(12)10(8)13;/h2,5,15H,3,14H2,1H3;1H/t5-;/m1./s1 |
| InChIKey | KLBCYVYYRMGLIZ-NUBCRITNSA-N |
| XLogP | 1.79 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|