C9H11F3N2O — CID 171257732
2-[(1R)-1,3-diaminopropyl]-3,4,5-trifluorophenol (PubChem CID 171257732) has the molecular formula C9H11F3N2O and a molecular weight of 220.19 g/mol. Its IUPAC name is 2-[(1R)-1,3-diaminopropyl]-3,4,5-trifluorophenol.
| Compound Name | 2-[(1R)-1,3-diaminopropyl]-3,4,5-trifluorophenol |
|---|---|
| PubChem CID | 171257732 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-[(1R)-1,3-diaminopropyl]-3,4,5-trifluorophenol |
| SMILES | NCC[C@@H](N)c1c(O)cc(F)c(F)c1F |
| InChI | InChI=1S/C9H11F3N2O/c10-4-3-6(15)7(5(14)1-2-13)9(12)8(4)11/h3,5,15H,1-2,13-14H2/t5-/m1/s1 |
| InChIKey | RDAXKZDJOSYLBW-RXMQYKEDSA-N |
| XLogP | 1.16 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|