C10H16N2O3 — CID 171236662
2-[(1S)-1,4-diaminobutyl]benzene-1,3,5-triol (PubChem CID 171236662) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[(1S)-1,4-diaminobutyl]benzene-1,3,5-triol.
| Compound Name | 2-[(1S)-1,4-diaminobutyl]benzene-1,3,5-triol |
|---|---|
| PubChem CID | 171236662 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[(1S)-1,4-diaminobutyl]benzene-1,3,5-triol |
| SMILES | NCCC[C@H](N)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C10H16N2O3/c11-3-1-2-7(12)10-8(14)4-6(13)5-9(10)15/h4-5,7,13-15H,1-3,11-12H2/t7-/m0/s1 |
| InChIKey | WFVMUXHCKLIUNB-ZETCQYMHSA-N |
| XLogP | 0.54 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|