C8H13ClN2O3 — CID 171236660
2-[(1R)-1,2-diaminoethyl]benzene-1,3,5-triol;hydrochloride (PubChem CID 171236660) has the molecular formula C8H13ClN2O3 and a molecular weight of 220.66 g/mol. Its IUPAC name is 2-[(1R)-1,2-diaminoethyl]benzene-1,3,5-triol;hydrochloride.
| Compound Name | 2-[(1R)-1,2-diaminoethyl]benzene-1,3,5-triol;hydrochloride |
|---|---|
| PubChem CID | 171236660 |
| Molecular Formula | C8H13ClN2O3 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-[(1R)-1,2-diaminoethyl]benzene-1,3,5-triol;hydrochloride |
| SMILES | Cl.NC[C@H](N)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C8H12N2O3.ClH/c9-3-5(10)8-6(12)1-4(11)2-7(8)13;/h1-2,5,11-13H,3,9-10H2;1H/t5-;/m0./s1 |
| InChIKey | XCOXDZMFMQEUTE-JEDNCBNOSA-N |
| XLogP | 0.18 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|