C12H15ClN2O — CID 171232039
1-[(1R)-1,2-diaminoethyl]naphthalen-2-ol;hydrochloride (PubChem CID 171232039) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 1-[(1R)-1,2-diaminoethyl]naphthalen-2-ol;hydrochloride.
| Compound Name | 1-[(1R)-1,2-diaminoethyl]naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171232039 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-[(1R)-1,2-diaminoethyl]naphthalen-2-ol;hydrochloride |
| SMILES | Cl.NC[C@H](N)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C12H14N2O.ClH/c13-7-10(14)12-9-4-2-1-3-8(9)5-6-11(12)15;/h1-6,10,15H,7,13-14H2;1H/t10-;/m0./s1 |
| InChIKey | NYXYPOHYOXRWIU-PPHPATTJSA-N |
| XLogP | 1.93 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|