C13H13ClF3NO — CID 171212454
1-[(1R)-1-amino-3,3,3-trifluoropropyl]naphthalen-2-ol;hydrochloride (PubChem CID 171212454) has the molecular formula C13H13ClF3NO and a molecular weight of 291.70 g/mol. Its IUPAC name is 1-[(1R)-1-amino-3,3,3-trifluoropropyl]naphthalen-2-ol;hydrochloride.
| Compound Name | 1-[(1R)-1-amino-3,3,3-trifluoropropyl]naphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171212454 |
| Molecular Formula | C13H13ClF3NO |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 1-[(1R)-1-amino-3,3,3-trifluoropropyl]naphthalen-2-ol;hydrochloride |
| SMILES | Cl.N[C@H](CC(F)(F)F)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C13H12F3NO.ClH/c14-13(15,16)7-10(17)12-9-4-2-1-3-8(9)5-6-11(12)18;/h1-6,10,18H,7,17H2;1H/t10-;/m1./s1 |
| InChIKey | GYQQCESQDRZRFL-HNCPQSOCSA-N |
| XLogP | 3.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|